Products 2246874-27-9
CAS 2246874-27-9 appears in our catalog under these names: (4-(Propylsulfonamidomethyl)phenyl)boronic acid, 95%, (4-(PRopylsulfonamidomethyl)phenyl)boronic acid, 98%, (4–(propylsulfonamidomethyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
[4-[(propylsulfonylamino)methyl]phenyl]boronic acid (CAS 2246874-27-9) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [4-[(propylsulfonylamino)methyl]phenyl]boronic acid. InChIKey: GIPZNWVNFOLKCC-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [4-[(propylsulfonylamino)methyl]phenyl]boronic acid |
| InChIKey | GIPZNWVNFOLKCC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNS(=O)(=O)CCC)(O)O |
Computed by PubChem (NCBI)