Products 2248388-79-4

CAS 2248388-79-4 is the registry number for Methyl 2-{8-oxa-5-azaspiro(3.5)nonan-7-yl}acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(8-oxa-5-azaspiro[3.5]nonan-7-yl)acetate;hydrochloride (CAS 2248388-79-4) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: methyl 2-(8-oxa-5-azaspiro[3.5]nonan-7-yl)acetate;hydrochloride. InChIKey: PMFCNFZCPWZFKA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClNO3
Molecular weight235.71 g/mol
IUPAC namemethyl 2-(8-oxa-5-azaspiro[3.5]nonan-7-yl)acetate;hydrochloride
InChIKeyPMFCNFZCPWZFKA-UHFFFAOYSA-N
SMILESCOC(=O)CC1CNC2(CCC2)CO1.Cl

Computed by PubChem (NCBI)