CAS 2251047-36-4 appears in our catalog under these names: Pirfenidone Impurity 18, Pirfenidone Impurity 8, Pirfenidone Impurity 14, 5-Methylpyridin-2-one Pirfenidone, >95% (HPLC), 1,1'-(1,4-Phenylene)bis(5-methylpyridin-2(1H)-one) 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
5-methyl-1-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl]pyridin-2-one (CAS 2251047-36-4) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 5-methyl-1-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl]pyridin-2-one. InChIKey: RLBFFAUFRAIGRD-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 5-methyl-1-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl]pyridin-2-one |
| InChIKey | RLBFFAUFRAIGRD-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=O)C=C1)C2=CC=C(C=C2)N3C=C(C=CC3=O)C |
Computed by PubChem (NCBI)