CAS 22531-53-9 is the registry number for 4-Chloro-1-naphthalene Ethanone. Offered by: TRC. Available pack sizes: 250mg.
1-(4-chloronaphthalen-1-yl)ethanone (CAS 22531-53-9) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 1-(4-chloronaphthalen-1-yl)ethanone. InChIKey: YEHPVVNRCJDKDF-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 1-(4-chloronaphthalen-1-yl)ethanone |
| InChIKey | YEHPVVNRCJDKDF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)