CAS 2253639-30-2 is the registry number for 5-Bromo-1-methoxy-2,7-naphthyridine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
5-bromo-1-methoxy-2,7-naphthyridine (CAS 2253639-30-2) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-bromo-1-methoxy-2,7-naphthyridine. InChIKey: QTBPRUCDUGSUGI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-bromo-1-methoxy-2,7-naphthyridine |
| InChIKey | QTBPRUCDUGSUGI-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC2=C(C=NC=C21)Br |
Computed by PubChem (NCBI)