Products 22550-15-8
CAS 22550-15-8 appears in our catalog under these names: Isocryptotanshinone, Isocryptotanshinone, 98.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1 mg, 5 mg.
(8S)-4,4,8-trimethyl-2,3,8,9-tetrahydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione (CAS 22550-15-8) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: (8S)-4,4,8-trimethyl-2,3,8,9-tetrahydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione. InChIKey: VUIHARLRBGHPEA-SNVBAGLBSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (8S)-4,4,8-trimethyl-2,3,8,9-tetrahydro-1H-naphtho[2,1-f][1]benzofuran-7,11-dione |
| InChIKey | VUIHARLRBGHPEA-SNVBAGLBSA-N |
| SMILES | C[C@@H]1COC2=C1C(=O)C3=C(C2=O)C4=C(C=C3)C(CCC4)(C)C |
Computed by PubChem (NCBI)