CAS 225645-97-6 is the registry number for 1,2-Diamino-4,5-dimethoxybenzene Hydrochloride. Offered by: TRC. Available pack sizes: 1g, 250mg, 50mg.
4,5-dimethoxybenzene-1,2-diamine;hydrochloride (CAS 225645-97-6) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: 4,5-dimethoxybenzene-1,2-diamine;hydrochloride. InChIKey: GARYQMCDGJSDRX-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 4,5-dimethoxybenzene-1,2-diamine;hydrochloride |
| InChIKey | GARYQMCDGJSDRX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)N)OC.Cl |
Computed by PubChem (NCBI)