CAS 22568-51-0 is the registry number for Dopamine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-4-[(E)-2-nitroethenyl]phenol (CAS 22568-51-0) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-methoxy-4-[(E)-2-nitroethenyl]phenol. InChIKey: XVXCSPJSXIUNQJ-SNAWJCMRSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-methoxy-4-[(E)-2-nitroethenyl]phenol |
| InChIKey | XVXCSPJSXIUNQJ-SNAWJCMRSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/[N+](=O)[O-])O |
Computed by PubChem (NCBI)