CAS 2259698-26-3 is the registry number for tert-Butyl 6,7-dimethyl-4-oxo-1,3,4,5-tetrahydro-2H-pyrrolo(3,4-c)pyridine-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 10g.
Tert-butyl 6,7-dimethyl-4-oxo-3,5-dihydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate (CAS 2259698-26-3) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: tert-butyl 6,7-dimethyl-4-oxo-3,5-dihydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate. InChIKey: IKQYKQCFNBXMNM-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | tert-butyl 6,7-dimethyl-4-oxo-3,5-dihydro-1H-pyrrolo[3,4-c]pyridine-2-carboxylate |
| InChIKey | IKQYKQCFNBXMNM-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=O)C2=C1CN(C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)