Products 2265209-26-3
CAS 2265209-26-3 is the registry number for 4-Amino-3,5-dichloro-2-methyl-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 4-amino-3,5-dichloro-2-methylbenzoate (CAS 2265209-26-3) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: methyl 4-amino-3,5-dichloro-2-methylbenzoate. InChIKey: ZGBCZBDKNGLVCR-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | methyl 4-amino-3,5-dichloro-2-methylbenzoate |
| InChIKey | ZGBCZBDKNGLVCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C(=O)OC)Cl)N)Cl |
Computed by PubChem (NCBI)