CAS 2271393-80-5 is the registry number for 3-(Bicyclo[4.2.0]octa-1,3,5-trien-3-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)propanoic acid (CAS 2271393-80-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)propanoic acid. InChIKey: ZNUAOJHFPYQVKU-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)propanoic acid |
| InChIKey | ZNUAOJHFPYQVKU-UHFFFAOYSA-N |
| SMILES | C1CC2=C1C=CC(=C2)CCC(=O)O |
Computed by PubChem (NCBI)