Products 2271393-80-5

CAS 2271393-80-5 is the registry number for 3-(Bicyclo[4.2.0]octa-1,3,5-trien-3-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)propanoic acid (CAS 2271393-80-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)propanoic acid. InChIKey: ZNUAOJHFPYQVKU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O2
Molecular weight176.21 g/mol
IUPAC name3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)propanoic acid
InChIKeyZNUAOJHFPYQVKU-UHFFFAOYSA-N
SMILESC1CC2=C1C=CC(=C2)CCC(=O)O

Computed by PubChem (NCBI)