CAS 2280-85-5 appears in our catalog under these names: 6-Methyl-DL-tryptophan, 97%, 2-Amino-3-(6-methyl-1H-indol-3-yl)propanoic acid, 97%, 6–Methyl–DL–tryptophan, 6-Methyl-DL-tryptophan, H-DL-Trp(6-Me)-OH 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 2,5g, 5g, 1 g, 50 mg.
2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid (CAS 2280-85-5) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid. InChIKey: GDMRVYIFGPMUCG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | GDMRVYIFGPMUCG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)