CAS 67008-97-3 appears in our catalog under these names: (R)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid, ≥98%, ≥98%, H-D-Trp(6-Me)-OH 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid (CAS 67008-97-3) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid. InChIKey: GDMRVYIFGPMUCG-SNVBAGLBSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | GDMRVYIFGPMUCG-SNVBAGLBSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)