CAS 33468-34-7 appears in our catalog under these names: 6-Methyl-l-tryptophan, 95%, 6-Methyl-L-tryptophan, H-Trp(6-Me)-OH 98%, L-6-Methyltryptophan, 98%, 98%, 6-METHYL-L-TRYPTOPHAN, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 250mg, 50mg, 25mg, 100mg, 1g.
(2S)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid (CAS 33468-34-7) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (2S)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid. InChIKey: GDMRVYIFGPMUCG-JTQLQIEISA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2S)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | GDMRVYIFGPMUCG-JTQLQIEISA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)