CAS 22808-29-3 appears in our catalog under these names: 4-tert-Butyl-3,6-dichloropyridazine, 97%, 97%, 4-tert-Butyl-3,6-dichloropyridazine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 100mg, 10g.
4-tert-butyl-3,6-dichloropyridazine (CAS 22808-29-3) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 4-tert-butyl-3,6-dichloropyridazine. InChIKey: DTUZXHRABOWYAE-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 4-tert-butyl-3,6-dichloropyridazine |
| InChIKey | DTUZXHRABOWYAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NN=C1Cl)Cl |
Computed by PubChem (NCBI)