CAS 228413-64-7 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine, 95%, 4-(3,4-Dichlorophenyl)-5-methylthiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine (CAS 228413-64-7) is a chemical compound with the molecular formula C10H8Cl2N2S and a molecular weight of 259.15 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine. InChIKey: QENQRTUPUKKHLA-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | QENQRTUPUKKHLA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)