CAS 40277-35-8 is the registry number for 2,4-Dichloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 40277-35-8) is a chemical compound with the molecular formula C10H8Cl2N2S and a molecular weight of 259.15 g/mol. IUPAC name: 2,4-dichloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: CPWQCJFDDILDOU-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2,4-dichloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | CPWQCJFDDILDOU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=C(N=C3Cl)Cl |
Computed by PubChem (NCBI)