CAS 302548-99-8 is the registry number for 5-(2,3-Dichloro-benzyl)-thiazol-2-ylamine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-amine (CAS 302548-99-8) is a chemical compound with the molecular formula C10H8Cl2N2S and a molecular weight of 259.15 g/mol. IUPAC name: 5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: FHYYBLWDYNACNA-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | FHYYBLWDYNACNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CC2=CN=C(S2)N |
Computed by PubChem (NCBI)