CAS 420102-86-9 is the registry number for 5-(3,4-Dichloro-benzyl)-thiazol-2-ylamine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine (CAS 420102-86-9) is a chemical compound with the molecular formula C10H8Cl2N2S and a molecular weight of 259.15 g/mol. IUPAC name: 5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: ZGYKWDAYSHDBDW-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | ZGYKWDAYSHDBDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=CN=C(S2)N)Cl)Cl |
Computed by PubChem (NCBI)