Products 643723-54-0
CAS 643723-54-0 is the registry number for [4-(2,4-Dichlorophenyl)-1,3-thiazol-2-yl]methanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methanamine (CAS 643723-54-0) is a chemical compound with the molecular formula C10H8Cl2N2S and a molecular weight of 259.15 g/mol. IUPAC name: [4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methanamine. InChIKey: SLZFKBZHWPHQHL-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | [4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methanamine |
| InChIKey | SLZFKBZHWPHQHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC(=N2)CN |
Computed by PubChem (NCBI)