CAS 90767-67-2 is the registry number for 4-((2,4-Dichlorophenyl)methyl)-1,3-thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine (CAS 90767-67-2) is a chemical compound with the molecular formula C10H8Cl2N2S and a molecular weight of 259.15 g/mol. IUPAC name: 4-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: PNEPXYRISUWLRT-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 4-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | PNEPXYRISUWLRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC2=CSC(=N2)N |
Computed by PubChem (NCBI)