Products 2287246-67-5
CAS 2287246-67-5 is the registry number for (8R)-1,4-Dioxa-7-azaspiro(4.4)nonane-8-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid (CAS 2287246-67-5) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid. InChIKey: WRHPVRWALQQWHH-RXMQYKEDSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylic acid |
| InChIKey | WRHPVRWALQQWHH-RXMQYKEDSA-N |
| SMILES | C1COC2(O1)C[C@@H](NC2)C(=O)O |
Computed by PubChem (NCBI)