Products 2287282-15-7
CAS 2287282-15-7 appears in our catalog under these names: 4-(Amino(phenyl)methyl)benzoic acid hydrochloride, 4-[amino(phenyl)methyl]benzoicacidhydrochloride, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
4-[amino(phenyl)methyl]benzoic acid;hydrochloride (CAS 2287282-15-7) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: 4-[amino(phenyl)methyl]benzoic acid;hydrochloride. InChIKey: BPHKNAFQMHSMOR-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 4-[amino(phenyl)methyl]benzoic acid;hydrochloride |
| InChIKey | BPHKNAFQMHSMOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)C(=O)O)N.Cl |
Computed by PubChem (NCBI)