CAS 2287300-30-3 is the registry number for 2,2-Dioxo-2λâ¶-thia-1-azabicyclo(2.2.2)octane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dioxo-2lambda6-thia-1-azabicyclo[2.2.2]octane-4-carboxylic acid (CAS 2287300-30-3) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: 2,2-dioxo-2lambda6-thia-1-azabicyclo[2.2.2]octane-4-carboxylic acid. InChIKey: BEKXJLGWRIYBAG-UHFFFAOYSA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2,2-dioxo-2lambda6-thia-1-azabicyclo[2.2.2]octane-4-carboxylic acid |
| InChIKey | BEKXJLGWRIYBAG-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1(CS2(=O)=O)C(=O)O |
Computed by PubChem (NCBI)