Products 2287342-23-6
CAS 2287342-23-6 is the registry number for 2-Amino-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid;hydrochloride (CAS 2287342-23-6) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid;hydrochloride. InChIKey: SUGWLOAEXHFNDR-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid;hydrochloride |
| InChIKey | SUGWLOAEXHFNDR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)O)N.Cl |
Computed by PubChem (NCBI)