Products 22888-56-8
CAS 22888-56-8 appears in our catalog under these names: 2-Amino-3-(3-nitrophenyl)propanoic acid, 95%, 2–Amino–3–(3–nitrophenyl)propanoic acid, 2-Amino-3-(3-nitrophenyl)propanoic acid, 97%, 97%, 2-Amino-3-(3-nitrophenyl)propanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg, 10g.
2-amino-3-(3-nitrophenyl)propanoic acid (CAS 22888-56-8) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 2-amino-3-(3-nitrophenyl)propanoic acid. InChIKey: YTHDRUZHNYKZGF-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 2-amino-3-(3-nitrophenyl)propanoic acid |
| InChIKey | YTHDRUZHNYKZGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-(3-nitrophenyl)propanoic acid, 3-Nitro-DL-Phenylalanine, 3-nitrophenylalanine, phenylalanine, 3-nitro-, hydrochloride, 2-Amino-3-(3-nitrophenyl)propanoicacid, m-nitrophenylalanine, Phenylalanine, 3-nitro-, 3-Nitrophenylalanine, DL-, DL-Phenylalanine, 3-nitro-, 3-(hydroxy(oxido)amino)phenylalanine