CAS 22920-31-6 is the registry number for (E)-1-(4-Methoxystyryl)naphthalene. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
1-[(E)-2-(4-methoxyphenyl)ethenyl]naphthalene (CAS 22920-31-6) is a chemical compound with the molecular formula C19H16O and a molecular weight of 260.3 g/mol. IUPAC name: 1-[(E)-2-(4-methoxyphenyl)ethenyl]naphthalene. InChIKey: MQYBSZOXRVIGDM-FMIVXFBMSA-N.
| Molecular formula | C19H16O |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 1-[(E)-2-(4-methoxyphenyl)ethenyl]naphthalene |
| InChIKey | MQYBSZOXRVIGDM-FMIVXFBMSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)