CAS 2298-28-4 appears in our catalog under these names: 1,3-Bis(4-hydroxyphenyl)-Urea, 1,3-Bis(4-hydroxyphenyl)urea, 97%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
1,3-bis(4-hydroxyphenyl)urea (CAS 2298-28-4) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 1,3-bis(4-hydroxyphenyl)urea. InChIKey: UPTYAUVZYHYTSF-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 1,3-bis(4-hydroxyphenyl)urea |
| InChIKey | UPTYAUVZYHYTSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)