Products 23043-88-1
CAS 23043-88-1 is the registry number for 7-Ethyl theophylline. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
7-ethyl-1,3-dimethylpurine-2,6-dione (CAS 23043-88-1) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 7-ethyl-1,3-dimethylpurine-2,6-dione. InChIKey: RPOQNHMXOPWCEK-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 7-ethyl-1,3-dimethylpurine-2,6-dione |
| InChIKey | RPOQNHMXOPWCEK-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Computed by PubChem (NCBI)
Synonyms:
7-Ethyltheophylline, Ethyltheophylline, Theophylline, 7-ethyl-, 7-Ethyl-1,3-dimethylxanthine, Ethylteofyllin, Ethyltheophylline (VAN), 1H-Purine-2,6-dione, 7-ethyl-3,7-dihydro-1,3-dimethyl-, 7-Ethyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, ETHYLTHEOPHYLLINE [VAN], Theophylline, 7-ethyl-(8CI)