CAS 2304634-89-5 is the registry number for Chroman-7-ylboronic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
3,4-dihydro-2H-chromen-7-ylboronic acid (CAS 2304634-89-5) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-7-ylboronic acid. InChIKey: MGPOHFRJVFWGRV-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-7-ylboronic acid |
| InChIKey | MGPOHFRJVFWGRV-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CCCO2)C=C1)(O)O |
Computed by PubChem (NCBI)