Products 2306249-19-2
CAS 2306249-19-2 is the registry number for Benzyl (R)-2-cyclopropyl-5-oxotetrahydro-2H-pyran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R)-2-cyclopropyl-5-oxooxane-2-carboxylate (CAS 2306249-19-2) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: benzyl (2R)-2-cyclopropyl-5-oxooxane-2-carboxylate. InChIKey: BUMDONFHXJZHLJ-MRXNPFEDSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | benzyl (2R)-2-cyclopropyl-5-oxooxane-2-carboxylate |
| InChIKey | BUMDONFHXJZHLJ-MRXNPFEDSA-N |
| SMILES | C1CC1[C@]2(CCC(=O)CO2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)