Products 2306260-70-6
CAS 2306260-70-6 is the registry number for 1-tert-butoxycarbonyl-2,3-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid (CAS 2306260-70-6) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid. InChIKey: FHFKKLMACSOTJH-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydropyrrolo[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | FHFKKLMACSOTJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(CC2=C1C=CN=C2)C(=O)O |
Computed by PubChem (NCBI)