CAS 926252-37-1 is the registry number for 3-((3-Oxopiperazin-1-yl)sulfonyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(3-oxopiperazin-1-yl)sulfonylbenzoic acid (CAS 926252-37-1) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: 3-(3-oxopiperazin-1-yl)sulfonylbenzoic acid. InChIKey: DUNOHUAXGDZSLY-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 3-(3-oxopiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | DUNOHUAXGDZSLY-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)