Products 63674-70-4

CAS 63674-70-4 appears in our catalog under these names: 5-Oxo-1-(3-sulfamoylphenyl)pyrrolidine-3-carboxylic acid, 95%, 5-Oxo-1-(3-sulfamoylphenyl)pyrrolidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

5-oxo-1-(3-sulfamoylphenyl)pyrrolidine-3-carboxylic acid (CAS 63674-70-4) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: 5-oxo-1-(3-sulfamoylphenyl)pyrrolidine-3-carboxylic acid. InChIKey: OQZBIRJTOGZMCR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O5S
Molecular weight284.29 g/mol
IUPAC name5-oxo-1-(3-sulfamoylphenyl)pyrrolidine-3-carboxylic acid
InChIKeyOQZBIRJTOGZMCR-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC(=CC=C2)S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)