Products 2307754-68-1
CAS 2307754-68-1 is the registry number for rac-4-((3R,4R)-4-Methylpyrrolidine-3-carbonyl)morpholine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride (CAS 2307754-68-1) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride. InChIKey: IKLGZHCANBKWGP-VTLYIQCISA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride |
| InChIKey | IKLGZHCANBKWGP-VTLYIQCISA-N |
| SMILES | C[C@@H]1CNC[C@H]1C(=O)N2CCOCC2.Cl |
Computed by PubChem (NCBI)