Products 23105-99-9
CAS 23105-99-9 is the registry number for 1-Amino-3-(2,3-dichlorophenoxy)propan-2-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-amino-3-(2,3-dichlorophenoxy)propan-2-ol (CAS 23105-99-9) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: 1-amino-3-(2,3-dichlorophenoxy)propan-2-ol. InChIKey: YNVGFONMHWYVLE-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 1-amino-3-(2,3-dichlorophenoxy)propan-2-ol |
| InChIKey | YNVGFONMHWYVLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCC(CN)O |
Computed by PubChem (NCBI)