CAS 23184-97-6 appears in our catalog under these names: 4-Chloro Cathinone Hydrochloride, 4–Chlorocathinone (hydrochloride), 2-Amino-1-(4-chlorophenyl)propan-1-one hydrochloride, 2-Amino-1-(4-chlorophenyl)propan-1-one (hydrochloride). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 100mg, 5 mg, 1 mg.
2-amino-1-(4-chlorophenyl)propan-1-one;hydrochloride (CAS 23184-97-6) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 2-amino-1-(4-chlorophenyl)propan-1-one;hydrochloride. InChIKey: XAAMOOOAKCTFIG-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 2-amino-1-(4-chlorophenyl)propan-1-one;hydrochloride |
| InChIKey | XAAMOOOAKCTFIG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)