Products 232261-31-3
CAS 232261-31-3 appears in our catalog under these names: 1,7-Diphenylhept-1-ene-3,5-diol, (3R,5S,E)-1,7-Diphenylhept-1-ene-3,5-diol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(E,3R,5S)-1,7-diphenylhept-1-ene-3,5-diol (CAS 232261-31-3) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: (E,3R,5S)-1,7-diphenylhept-1-ene-3,5-diol. InChIKey: YSRHCYXKOMRFPK-VDYYAZEHSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | (E,3R,5S)-1,7-diphenylhept-1-ene-3,5-diol |
| InChIKey | YSRHCYXKOMRFPK-VDYYAZEHSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C[C@H](/C=C/C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)