Products 232951-83-6
CAS 232951-83-6 appears in our catalog under these names: tert–Butyl 2–chloronicotinate, tert-Butyl 2-chloronicotinate, tert-Butyl 2-chloronicotinate 96%, tert-butyl 2-chloronicotinate, 98%, 98%, tert-Butyl 2-chloronicotinate, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
Tert-butyl 2-chloropyridine-3-carboxylate (CAS 232951-83-6) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 2-chloropyridine-3-carboxylate. InChIKey: BKRYJISKTILWAE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 2-chloropyridine-3-carboxylate |
| InChIKey | BKRYJISKTILWAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)