Products 66885-68-5
CAS 66885-68-5 appears in our catalog under these names: (E)-3-(4-Formylphenyl)acrylic acid, 97+%, Ozagrel Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(4-formylphenyl)prop-2-enoic acid (CAS 66885-68-5) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-3-(4-formylphenyl)prop-2-enoic acid. InChIKey: LBOUHDMYVURTMA-AATRIKPKSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-3-(4-formylphenyl)prop-2-enoic acid |
| InChIKey | LBOUHDMYVURTMA-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)C=O |
Computed by PubChem (NCBI)
Synonyms:
p-Formylcinnamic acid, p-Formylcinnamicacid, p-formyl-cinnamic acid, 4-Formylcinnamic acid, 3-(4-formylphenyl)acrylic acid, (E)-3-(4-formylphenyl)acrylic acid, (E)-3-(4-formylphenyl)prop-2-enoic acid, 4-Formylcinnamic acid, predominantly trans, (2E)-3-(4-Formylphenyl)Prop-2-Enoic Acid, 2-Propenoic acid, 3-(4-formylphenyl)-, (2E)-