CAS 23418-85-1 appears in our catalog under these names: Propargyl–Tos, 3-Butynyl p-toluenesulfonate, 96% , 3-Butynyl p-Toluenesulfonate, >97.0%(GC), 3-Butynyl p-toluenesulfonate, 96%, Propargyl-Tos 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 500mg, 5g, 25g, 100g, 500g, 10g, 10 g.
But-3-ynyl 4-methylbenzenesulfonate (CAS 23418-85-1) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: but-3-ynyl 4-methylbenzenesulfonate. InChIKey: STOASOOVVADOKH-UHFFFAOYSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | but-3-ynyl 4-methylbenzenesulfonate |
| InChIKey | STOASOOVVADOKH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC#C |
Computed by PubChem (NCBI)