CAS 676133-50-9 is the registry number for 6-Ethylisothiochroman-4-one 2,2-dioxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethyl-2,2-dioxo-1H-isothiochromen-4-one (CAS 676133-50-9) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: 6-ethyl-2,2-dioxo-1H-isothiochromen-4-one. InChIKey: GUWUZKCZQYXBSB-UHFFFAOYSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 6-ethyl-2,2-dioxo-1H-isothiochromen-4-one |
| InChIKey | GUWUZKCZQYXBSB-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(CS(=O)(=O)CC2=O)C=C1 |
Computed by PubChem (NCBI)