Products 57359-76-9
CAS 57359-76-9 is the registry number for A188805. Offered by: TRC. Available pack sizes: 2,5g.
(2R)-2-acetylsulfanyl-3-phenylpropanoic acid (CAS 57359-76-9) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: (2R)-2-acetylsulfanyl-3-phenylpropanoic acid. InChIKey: UOVSNFYJYANSNI-SNVBAGLBSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | (2R)-2-acetylsulfanyl-3-phenylpropanoic acid |
| InChIKey | UOVSNFYJYANSNI-SNVBAGLBSA-N |
| SMILES | CC(=O)S[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Acetylthio-3-phenylpropionic Acid, (2R)-2-acetylsulfanyl-3-phenylpropanoic acid, Furazabol (1.0 mg/mL in Acetonitrile), ((?R)-?-(Acetylthio)benzenepropanoic acid), 2(R)-Acetylthio-benzenepropanoic acid, (R)-2-(Aacetylthio)-3-phenylpropanoic acid, (R)-2-Acetylsulfanyl-3-phenyl-propionic acid