CAS 516453-68-2 is the registry number for 2-Methyl-1-(4-(methylsulfonyl)phenyl)-2-propen-1-one. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
2-methyl-1-(4-methylsulfonylphenyl)prop-2-en-1-one (CAS 516453-68-2) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: 2-methyl-1-(4-methylsulfonylphenyl)prop-2-en-1-one. InChIKey: UFXOWVCXRPOLGB-UHFFFAOYSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 2-methyl-1-(4-methylsulfonylphenyl)prop-2-en-1-one |
| InChIKey | UFXOWVCXRPOLGB-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)C1=CC=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)