Products 2941312-90-7
CAS 2941312-90-7 is the registry number for (2R)-but-3-yn-2-yl 4-methylbenzene-1-sulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-but-3-yn-2-yl] 4-methylbenzenesulfonate (CAS 2941312-90-7) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: [(2R)-but-3-yn-2-yl] 4-methylbenzenesulfonate. InChIKey: XWRDBUBKBUYLQI-SNVBAGLBSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | [(2R)-but-3-yn-2-yl] 4-methylbenzenesulfonate |
| InChIKey | XWRDBUBKBUYLQI-SNVBAGLBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H](C)C#C |
Computed by PubChem (NCBI)