CAS 372112-46-4 is the registry number for (2R)-1,3-Oxathiolan-2-ylmethyl benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[(2R)-1,3-oxathiolan-2-yl]methyl benzoate (CAS 372112-46-4) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: [(2R)-1,3-oxathiolan-2-yl]methyl benzoate. InChIKey: PCXPPEVXIKTQGP-SNVBAGLBSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | [(2R)-1,3-oxathiolan-2-yl]methyl benzoate |
| InChIKey | PCXPPEVXIKTQGP-SNVBAGLBSA-N |
| SMILES | C1CS[C@@H](O1)COC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)