Products 234750-98-2
CAS 234750-98-2 is the registry number for Methyl 4-(cyclopentylamino)-3-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 4-(cyclopentylamino)-3-nitrobenzoate (CAS 234750-98-2) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: methyl 4-(cyclopentylamino)-3-nitrobenzoate. InChIKey: LEGFARQJQCCUBI-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | methyl 4-(cyclopentylamino)-3-nitrobenzoate |
| InChIKey | LEGFARQJQCCUBI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)NC2CCCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)