CAS 2350-46-1 is the registry number for 1-(2,3-Dichloro-4-hydroxyphenyl)butan-1-one. Offered by: TRC. Available pack sizes: 1g.
1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one (CAS 2350-46-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one. InChIKey: MRAKITVQDPSLMI-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one |
| InChIKey | MRAKITVQDPSLMI-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(C(=C(C=C1)O)Cl)Cl |
Computed by PubChem (NCBI)