CAS 2350834-33-0 is the registry number for (1R,2S)-2-(2-Fluorophenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-2-(2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 2350834-33-0) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: cis-(1R,2S)-2-(2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: OLDXGEXZLWOGJN-HTQZYQBOSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | cis-(1R,2S)-2-(2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | OLDXGEXZLWOGJN-HTQZYQBOSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)