Products 2358572-43-5

CAS 2358572-43-5 is the registry number for Methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate (CAS 2358572-43-5) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate. InChIKey: NXHIAZSRJPPKAH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11F2NO2
Molecular weight215.20 g/mol
IUPAC namemethyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate
InChIKeyNXHIAZSRJPPKAH-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)N)C(C(=O)OC)(F)F

Computed by PubChem (NCBI)