CAS 2358572-43-5 is the registry number for Methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate (CAS 2358572-43-5) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate. InChIKey: NXHIAZSRJPPKAH-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | methyl 2-(4-amino-2-methylphenyl)-2,2-difluoroacetate |
| InChIKey | NXHIAZSRJPPKAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C(C(=O)OC)(F)F |
Computed by PubChem (NCBI)